| Ad | 2-Chloropropylene |
|---|---|
| CAS No | 557-98-2 |
| EC No | 209-187-5 |
| Formül | C3H5Cl |
| SMILES | ClC(=C)C |
| InChI | InChI=1/C3H5Cl/c1-3(2)4/h1H2,2H3 |
| Molar Heat of Combustion | 1760.1 kJ/mol |
| Vapour Density | 2.6417 |
| Stoichiometric Concentration | 4.9771 %v |
| Substance Type | Flammable |
| State of Matter | Gas |
| Molecular Weight | 76.53 g/mol |
| Molar Volume | 85.137 cm3/mol |
| Density | 0.8989 g/cm3 |
| Boiling Point | 296.36 K (23.211°C) |
| Specific Heat Ratio | 1.12 |
| Specific Heat of Combustion | 22.999 MJ/kg (22999 kJ/kg) |
| Lower Flammability Limit | 4.5 %v |
| Upper Flammability Limit | 16 %v |
| RMP Plume Type | Dense |
| RMP Toxic Endpoint | 100 mg/L |
| RMP Density Factor | 0.54 ft2/lb |
| RMP Gas Factor | 29 |
| RMP Liquid Factor Boiling | 0.16 |
| RMP Flash Fraction Factor | 0.011 |
| RMP Pool Fire Factor | 3.3 |
| Erişim | Genel |
Risk Değerlendirmesi | Doğal Afetler | Endüstriyel Tesisler | Bilimsel | Kullanıcılar |