| Ad | 2-Methyl-1-butene |
|---|---|
| CAS No | 563-46-2 |
| EC No | 209-250-7 |
| Formül | C5H10 |
| SMILES | C=C(C)CC |
| InChI | InChI=1/C5H10/c1-4-5(2)3/h2,4H2,1,3H3 |
| Molar Heat of Combustion | 3114.8 kJ/mol |
| Vapour Density | 2.4208 |
| Stoichiometric Concentration | 2.7176 %v |
| Substance Type | Flammable |
| State of Matter | Liquid |
| Molecular Weight | 70.13 g/mol |
| Molar Volume | 108.36 cm3/mol |
| Density | 0.6472 g/cm3 |
| Boiling Point | 298.24 K (25.089°C) |
| Specific Heat of Combustion | 44.414 MJ/kg (44414 kJ/kg) |
| Lower Flammability Limit | 1.4 %v |
| Upper Flammability Limit | 9.6 %v |
| RMP Plume Type | Dense |
| RMP Toxic Endpoint | 100 mg/L |
| RMP Density Factor | 0.75 ft2/lb |
| RMP Liquid Factor Ambient | 0.12 |
| RMP Liquid Factor Boiling | 0.15 |
| RMP Liquid Leak Factor | 31 |
| RMP Pool Fire Factor | 5.8 |
| Erişim | Genel |
Risk Değerlendirmesi | Doğal Afetler | Endüstriyel Tesisler | Bilimsel | Kullanıcılar |