Substance
| Name | 3-Methyl-1-butene |
|---|---|
| CAS No | 563-45-1 |
| EC No | 209-249-1 |
| Formula | C5H10 |
| SMILES | C=CC(C)C |
| InChI | InChI=1/C5H10/c1-4-5(2)3/h4-5H,1H2,2-3H3 |
| Molar Heat of Combustion | 3124.9 kJ/mol |
| Vapour Density | 2.4208 |
| Stoichiometric Concentration | 2.7176 %v |
| Substance Type | Flammable |
| State of Matter | Gas |
| Molecular Weight | 70.13 g/mol |
| Molar Volume | 111.25 cm3/mol |
| Density | 0.6304 g/cm3 |
| Boiling Point | 298.24 K (25.089°C) |
| Specific Heat Ratio | 1.08 |
| Specific Heat of Combustion | 44.559 MJ/kg (44559 kJ/kg) |
| Lower Flammability Limit | 1.5 %v |
| Upper Flammability Limit | 9.1 %v |
| RMP Plume Type | Dense |
| RMP Toxic Endpoint | 100 mg/L |
| RMP Density Factor | 0.77 ft2/lb |
| RMP Gas Factor | 26 |
| RMP Liquid Factor Boiling | 0.15 |
| RMP Flash Fraction Factor | 0.03 |
| RMP Pool Fire Factor | 6 |
| Access | Public |
Created: System
Risk Assessment | Natural Hazards | Industrial Plants | Scientific | Users |