Substance
| Name | 2-Methylpropene |
|---|---|
| CAS No | 115-11-7 |
| EC No | 204-066-3 |
| EC Index No | 601-012-00-4 |
| Formula | C4H8 |
| SMILES | C=C(C)C |
| InChI | InChI=1/C4H8/c1-4(2)3/h1H2,2-3H3 |
| Molar Heat of Combustion | 2524.1 kJ/mol |
| Vapour Density | 1.9368 |
| Stoichiometric Concentration | 3.374 %v |
| Substance Type | Flammable |
| State of Matter | Gas |
| Molecular Weight | 56.11 g/mol |
| Molar Volume | 89.007 cm3/mol |
| Density | 0.6304 g/cm3 |
| Boiling Point | 275.39 K (2.2425°C) |
| Specific Heat Ratio | 1.1 |
| Specific Heat of Combustion | 44.985 MJ/kg (44985 kJ/kg) |
| Lower Flammability Limit | 1.8 %v |
| Upper Flammability Limit | 8.8 %v |
| RMP Plume Type | Dense |
| RMP Toxic Endpoint | 100 mg/L |
| RMP Density Factor | 0.77 ft2/lb |
| RMP Gas Factor | 24 |
| RMP Liquid Factor Boiling | 0.14 |
| RMP Flash Fraction Factor | 0.18 |
| RMP Pool Fire Factor | 5.7 |
| Access | Public |
Created: System
Risk Assessment | Natural Hazards | Industrial Plants | Scientific | Users |