Substance
| Name | Acetic acid |
|---|---|
| CAS No | 64-19-7 |
| EC No | 200-580-7 |
| EC Index No | 607-002-00-6 |
| Formula | C2H4O2 |
| SMILES | O=C(O)C |
| InChI | InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
| UN Number | 2789 |
| SubstanceID_ADAM | 204 |
| Molar Heat of Combustion | 873 kJ/mol |
| NFPA Flammability Class | Class II |
| Vapour Density | 2.0728 |
| Volumetric Heat Capacity | 2150406 J/m3·K |
| Stoichiometric Concentration | 9.4823 %v |
| Substance Type | Flammable |
| State of Matter | Liquid |
| Molecular Weight | 60.05 g/mol |
| Molar Volume | 57.245 cm3/mol |
| Density | 1.049 g/cm3 |
| Boiling Point | 118–119°C |
| Melting Point | 16–17°C |
| Specific Heat of Vaporization | 870.94 kJ/kg |
| Molar Enthalpy of Vaporization | 52.3 kJ/mol |
| Specific Heat Capacity | 2050 J/kg·K |
| Molar Heat Capacity | 123.1 J/mol·K |
| Specific Heat of Combustion | 14538 kJ/kg |
| Autoignition Temperature | 427°C (700.15 K) |
| Flash Point | 39°C |
| Lower Flammability Limit | 5.4 %v |
| Upper Flammability Limit | 16 %v |
| RMP Toxic Endpoint | 0.08579 mg/L |
| RMP Density Factor | 0.4627 ft2/lb |
| RMP Liquid Factor Boiling | 0.103 |
| ERPG-1 Concentration | 5 ppm |
| ERPG-3 Concentration | 250 ppm |
| ERPG-2 Concentration | 35 ppm |
| Access | Public |
Risk Assessment | Natural Hazards | Industrial Plants | Scientific | Users |